C10H21F6N4P — CID 16733380
[(E)-3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate (PubChem CID 16733380) has the molecular formula C10H21F6N4P and a molecular weight of 342.27 g/mol. Its IUPAC name is [(E)-3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate.
| Compound Name | [(E)-3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate |
|---|---|
| PubChem CID | 16733380 |
| Molecular Formula | C10H21F6N4P |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [(E)-3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate |
| SMILES | CN(C)/C=N/C(C=[N+](C)C)=C/N(C)C.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C10H21N4.F6P/c1-12(2)7-10(8-13(3)4)11-9-14(5)6;1-7(2,3,4,5)6/h7-9H,1-6H3;/q+1;-1/b11-9+; |
| InChIKey | GRXVCYNCNPTQPV-LBEJWNQZSA-N |
| XLogP | 3.70 |
| TPSA | 21.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|