O30P10-10 — CID 154734535
2,4,6,8,10,12,14,16,18,20-decaoxido-1,3,5,7,9,11,13,15,17,19-decaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5,14λ5,16λ5,18λ5,20λ5-decaphosphacycloicosane 2,4,6,8,10,12,14,16,18,20-decaoxide (PubChem CID 154734535) has the molecular formula O30P10-10 and a molecular weight of 789.71 g/mol. Its IUPAC name is 2,4,6,8,10,12,14,16,18,20-decaoxido-1,3,5,7,9,11,13,15,17,19-decaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5,14λ5,16λ5,18λ5,20λ5-decaphosphacycloicosane 2,4,6,8,10,12,14,16,18,20-decaoxide.
| Compound Name | 2,4,6,8,10,12,14,16,18,20-decaoxido-1,3,5,7,9,11,13,15,17,19-decaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5,14λ5,16λ5,18λ5,20λ5-decaphosphacycloicosane 2,4,6,8,10,12,14,16,18,20-decaoxide |
|---|---|
| PubChem CID | 154734535 |
| Molecular Formula | O30P10-10 |
| Molecular Weight | 789.71 g/mol |
| Exact Mass | 789.59 |
| IUPAC Name | 2,4,6,8,10,12,14,16,18,20-decaoxido-1,3,5,7,9,11,13,15,17,19-decaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5,14λ5,16λ5,18λ5,20λ5-decaphosphacycloicosane 2,4,6,8,10,12,14,16,18,20-decaoxide |
| SMILES | O=P1([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O1 |
| InChI | InChI=1S/H10O30P10/c1-31(2)21-32(3,4)23-34(7,8)25-36(11,12)27-38(15,16)29-40(19,20)30-39(17,18)28-37(13,14)26-35(9,10)24-33(5,6)22-31/h(H,1,2)(H,3,4)(H,5,6)(H,7,8)(H,9,10)(H,11,12)(H,13,14)(H,15,16)(H,17,18)(H,19,20)/p-10 |
| InChIKey | PXKYPTIVXVGZTR-UHFFFAOYSA-D |
| XLogP | -5.15 |
| TPSA | 493.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 30 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.71 |
| LogP ≤ 5 | -5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 30 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|