C18H23F2N3O3 — CID 154737191
[5-(difluoromethoxy)-1-methylpyrazol-3-yl]-[2-(5-ethylfuran-2-yl)azepan-1-yl]methanone (PubChem CID 154737191) has the molecular formula C18H23F2N3O3 and a molecular weight of 367.40 g/mol. Its IUPAC name is [5-(difluoromethoxy)-1-methylpyrazol-3-yl]-[2-(5-ethylfuran-2-yl)azepan-1-yl]methanone.
| Compound Name | [5-(difluoromethoxy)-1-methylpyrazol-3-yl]-[2-(5-ethylfuran-2-yl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 154737191 |
| Molecular Formula | C18H23F2N3O3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [5-(difluoromethoxy)-1-methylpyrazol-3-yl]-[2-(5-ethylfuran-2-yl)azepan-1-yl]methanone |
| SMILES | CCc1ccc(C2CCCCCN2C(=O)c2cc(OC(F)F)n(C)n2)o1 |
| InChI | InChI=1S/C18H23F2N3O3/c1-3-12-8-9-15(25-12)14-7-5-4-6-10-23(14)17(24)13-11-16(22(2)21-13)26-18(19)20/h8-9,11,14,18H,3-7,10H2,1-2H3 |
| InChIKey | ZSLSLZBHRROYNZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |