C12H18N2O3S — CID 154739901
N-methyl-N-(oxan-3-ylmethyl)pyridine-3-sulfonamide (PubChem CID 154739901) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N-methyl-N-(oxan-3-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | N-methyl-N-(oxan-3-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 154739901 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-methyl-N-(oxan-3-ylmethyl)pyridine-3-sulfonamide |
| SMILES | CN(CC1CCCOC1)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-14(9-11-4-3-7-17-10-11)18(15,16)12-5-2-6-13-8-12/h2,5-6,8,11H,3-4,7,9-10H2,1H3 |
| InChIKey | FCDIZYWMSZHSGL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |