C11H17N3O5S — CID 63712565
5-[methyl(oxan-3-ylmethyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 63712565) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is 5-[methyl(oxan-3-ylmethyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[methyl(oxan-3-ylmethyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 63712565 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5-[methyl(oxan-3-ylmethyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | CN(CC1CCCOC1)S(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C11H17N3O5S/c1-14(6-8-3-2-4-19-7-8)20(17,18)10-9(11(15)16)5-12-13-10/h5,8H,2-4,6-7H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | IIRBSMKJYDTBGE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |