C14H15F2N5O3 — CID 154742273
5-[3-[4-(difluoromethoxy)phenyl]propanoylamino]-N-methyl-2H-triazole-4-carboxamide (PubChem CID 154742273) has the molecular formula C14H15F2N5O3 and a molecular weight of 339.30 g/mol. Its IUPAC name is 5-[3-[4-(difluoromethoxy)phenyl]propanoylamino]-N-methyl-2H-triazole-4-carboxamide.
| Compound Name | 5-[3-[4-(difluoromethoxy)phenyl]propanoylamino]-N-methyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 154742273 |
| Molecular Formula | C14H15F2N5O3 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-[3-[4-(difluoromethoxy)phenyl]propanoylamino]-N-methyl-2H-triazole-4-carboxamide |
| SMILES | CNC(=O)c1n[nH]nc1NC(=O)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H15F2N5O3/c1-17-13(23)11-12(20-21-19-11)18-10(22)7-4-8-2-5-9(6-3-8)24-14(15)16/h2-3,5-6,14H,4,7H2,1H3,(H,17,23)(H2,18,19,20,21,22) |
| InChIKey | XKQQIDPAYDWQGJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |