About N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide
N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide (PubChem CID 154742967) has the molecular formula C13H25N3O2
and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide |
| PubChem CID | 154742967 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide |
| SMILES | CC1CN(CCO)CCN1C(=O)N[C@H]1CC1(C)C |
| InChI | InChI=1S/C13H25N3O2/c1-10-9-15(6-7-17)4-5-16(10)12(18)14-11-8-13(11,2)3/h10-11,17H,4-9H2,1-3H3,(H,14,18)/t10?,11-/m0/s1 |
| InChIKey | YXVAQAHUBLKMRT-DTIOYNMSSA-N |
| XLogP | 0.49 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide?
The IUPAC name of N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide (CID 154742967) is N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide.
What is the SMILES notation for N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide?
The canonical SMILES for N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide is CC1CN(CCO)CCN1C(=O)N[C@H]1CC1(C)C.
What is the InChIKey of N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide?
The InChIKey is YXVAQAHUBLKMRT-DTIOYNMSSA-N. The full InChI is InChI=1S/C13H25N3O2/c1-10-9-15(6-7-17)4-5-16(10)12(18)14-11-8-13(11,2)3/h10-11,17H,4-9H2,1-3H3,(H,14,18)/t10?,11-/m0/s1.
What are the key properties of N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide?
N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide has a molecular weight of 255.36 g/mol, XLogP of 0.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-2,2-dimethylcyclopropyl]-4-(2-hydroxyethyl)-2-methylpiperazine-1-carboxamide is sourced from PubChem (CID 154742967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).