C15H20F3N5O3 — CID 154743242
3-[5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-3-yl]-4-[3-(2,2,2-trifluoroethoxy)propyl]morpholine (PubChem CID 154743242) has the molecular formula C15H20F3N5O3 and a molecular weight of 375.35 g/mol. Its IUPAC name is 3-[5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-3-yl]-4-[3-(2,2,2-trifluoroethoxy)propyl]morpholine.
| Compound Name | 3-[5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-3-yl]-4-[3-(2,2,2-trifluoroethoxy)propyl]morpholine |
|---|---|
| PubChem CID | 154743242 |
| Molecular Formula | C15H20F3N5O3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-[5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-3-yl]-4-[3-(2,2,2-trifluoroethoxy)propyl]morpholine |
| SMILES | Cn1cc(-c2nc(C3COCCN3CCCOCC(F)(F)F)no2)cn1 |
| InChI | InChI=1S/C15H20F3N5O3/c1-22-8-11(7-19-22)14-20-13(21-26-14)12-9-24-6-4-23(12)3-2-5-25-10-15(16,17)18/h7-8,12H,2-6,9-10H2,1H3 |
| InChIKey | IOZMOGPATQXIGY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|