C14H15N3O5S — CID 154743695
4-[[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylamino]benzoic acid (PubChem CID 154743695) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is 4-[[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 154743695 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-[[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cnn(C3CCOC3)c2)cc1 |
| InChI | InChI=1S/C14H15N3O5S/c18-14(19)10-1-3-11(4-2-10)16-23(20,21)13-7-15-17(8-13)12-5-6-22-9-12/h1-4,7-8,12,16H,5-6,9H2,(H,18,19) |
| InChIKey | XHWDWSFMHPLOCA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |