C14H14N2O5S — CID 154746143
4-[(5-methoxy-3-pyridinyl)sulfonyl-methylamino]benzoic acid (PubChem CID 154746143) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-[(5-methoxy-3-pyridinyl)sulfonyl-methylamino]benzoic acid.
| Compound Name | 4-[(5-methoxy-3-pyridinyl)sulfonyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 154746143 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-[(5-methoxy-3-pyridinyl)sulfonyl-methylamino]benzoic acid |
| SMILES | COc1cncc(S(=O)(=O)N(C)c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C14H14N2O5S/c1-16(11-5-3-10(4-6-11)14(17)18)22(19,20)13-7-12(21-2)8-15-9-13/h3-9H,1-2H3,(H,17,18) |
| InChIKey | HVZNPEQUOBXPBV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |