C18H24N2O2 — CID 15474643
(2R)-2-[[(2S,3S)-2-(furan-2-yl)azepan-3-yl]amino]-2-phenylethanol (PubChem CID 15474643) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R)-2-[[(2S,3S)-2-(furan-2-yl)azepan-3-yl]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[[(2S,3S)-2-(furan-2-yl)azepan-3-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 15474643 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2R)-2-[[(2S,3S)-2-(furan-2-yl)azepan-3-yl]amino]-2-phenylethanol |
| SMILES | OC[C@H](N[C@H]1CCCCN[C@@H]1c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O2/c21-13-16(14-7-2-1-3-8-14)20-15-9-4-5-11-19-18(15)17-10-6-12-22-17/h1-3,6-8,10,12,15-16,18-21H,4-5,9,11,13H2/t15-,16-,18-/m0/s1 |
| InChIKey | NHDKCZJXMBADQK-BQFCYCMXSA-N |
| XLogP | 2.79 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |