C9H14N2O — CID 82125093
2-(furan-2-yl)piperidin-3-amine (PubChem CID 82125093) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(furan-2-yl)piperidin-3-amine.
| Compound Name | 2-(furan-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 82125093 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-(furan-2-yl)piperidin-3-amine |
| SMILES | NC1CCCNC1c1ccco1 |
| InChI | InChI=1S/C9H14N2O/c10-7-3-1-5-11-9(7)8-4-2-6-12-8/h2,4,6-7,9,11H,1,3,5,10H2 |
| InChIKey | OLVWLYXNYOGOGH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |