C19H30N6O2 — CID 154746493
2-[2-(aminomethyl)-4-methylpiperazin-1-yl]-2-oxo-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]acetamide (PubChem CID 154746493) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-methylpiperazin-1-yl]-2-oxo-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]acetamide.
| Compound Name | 2-[2-(aminomethyl)-4-methylpiperazin-1-yl]-2-oxo-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 154746493 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2-[2-(aminomethyl)-4-methylpiperazin-1-yl]-2-oxo-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]acetamide |
| SMILES | CN1CCN(C(=O)C(=O)NCC2CCN(c3ccncc3)CC2)C(CN)C1 |
| InChI | InChI=1S/C19H30N6O2/c1-23-10-11-25(17(12-20)14-23)19(27)18(26)22-13-15-4-8-24(9-5-15)16-2-6-21-7-3-16/h2-3,6-7,15,17H,4-5,8-14,20H2,1H3,(H,22,26) |
| InChIKey | KAFJJTBXBDQKLJ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|