C16H22N8 — CID 154748330
6-[2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 154748330) has the molecular formula C16H22N8 and a molecular weight of 326.41 g/mol. Its IUPAC name is 6-[2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 154748330 |
| Molecular Formula | C16H22N8 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 6-[2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cc1nc(C)n(CC2CCCCN2c2ccc3nnc(C)n3n2)n1 |
| InChI | InChI=1S/C16H22N8/c1-11-17-12(2)23(20-11)10-14-6-4-5-9-22(14)16-8-7-15-19-18-13(3)24(15)21-16/h7-8,14H,4-6,9-10H2,1-3H3 |
| InChIKey | LOBHDELWAJPKQJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |