C16H22N8 — CID 95336447
7-[(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 95336447) has the molecular formula C16H22N8 and a molecular weight of 326.41 g/mol. Its IUPAC name is 7-[(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-[(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 95336447 |
| Molecular Formula | C16H22N8 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 7-[(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(N2CCCC[C@H]2Cn2nc(C)nc2C)n2ncnc2n1 |
| InChI | InChI=1S/C16H22N8/c1-11-8-15(24-16(19-11)17-10-18-24)22-7-5-4-6-14(22)9-23-13(3)20-12(2)21-23/h8,10,14H,4-7,9H2,1-3H3/t14-/m0/s1 |
| InChIKey | WJFOTZDTEGDUJG-AWEZNQCLSA-N |
| XLogP | 1.70 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |