C17H16N4O2 — CID 154749513
1-pyridin-3-ylethyl 3-methyl-4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 154749513) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-pyridin-3-ylethyl 3-methyl-4-(1,2,4-triazol-1-yl)benzoate.
| Compound Name | 1-pyridin-3-ylethyl 3-methyl-4-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 154749513 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-pyridin-3-ylethyl 3-methyl-4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | Cc1cc(C(=O)OC(C)c2cccnc2)ccc1-n1cncn1 |
| InChI | InChI=1S/C17H16N4O2/c1-12-8-14(5-6-16(12)21-11-19-10-20-21)17(22)23-13(2)15-4-3-7-18-9-15/h3-11,13H,1-2H3 |
| InChIKey | SXCULYPMWWCHBJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |