About 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate
1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate (PubChem CID 86813324) has the molecular formula C13H13BrN2O2
and a molecular weight of 309.16 g/mol. Its IUPAC name is 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate |
| PubChem CID | 86813324 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate |
| SMILES | CC(OC(=O)c1cc(Br)cn1C)c1cccnc1 |
| InChI | InChI=1S/C13H13BrN2O2/c1-9(10-4-3-5-15-7-10)18-13(17)12-6-11(14)8-16(12)2/h3-9H,1-2H3 |
| InChIKey | CMRNBMCXFMIVRB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate?
The IUPAC name of 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate (CID 86813324) is 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate.
What is the SMILES notation for 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate?
The canonical SMILES for 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate is CC(OC(=O)c1cc(Br)cn1C)c1cccnc1.
What is the InChIKey of 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate?
The InChIKey is CMRNBMCXFMIVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O2/c1-9(10-4-3-5-15-7-10)18-13(17)12-6-11(14)8-16(12)2/h3-9H,1-2H3.
What are the key properties of 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate?
1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate has a molecular weight of 309.16 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-ylethyl 4-bromo-1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 86813324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).