C11H10BrFN2OS — CID 154752418
(5-bromo-2-sulfanylidene-1H-pyridin-3-yl)-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 154752418) has the molecular formula C11H10BrFN2OS and a molecular weight of 317.18 g/mol. Its IUPAC name is (5-bromo-2-sulfanylidene-1H-pyridin-3-yl)-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (5-bromo-2-sulfanylidene-1H-pyridin-3-yl)-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 154752418 |
| Molecular Formula | C11H10BrFN2OS |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | (5-bromo-2-sulfanylidene-1H-pyridin-3-yl)-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(c1cc(Br)c[nH]c1=S)N1CCC=C(F)C1 |
| InChI | InChI=1S/C11H10BrFN2OS/c12-7-4-9(10(17)14-5-7)11(16)15-3-1-2-8(13)6-15/h2,4-5H,1,3,6H2,(H,14,17) |
| InChIKey | WIQPXXIPKNZKEG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|