C16H16ClN3O3 — CID 154752929
methyl 4-chloro-2-methyl-3-(pyridin-3-ylmethylcarbamoylamino)benzoate (PubChem CID 154752929) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is methyl 4-chloro-2-methyl-3-(pyridin-3-ylmethylcarbamoylamino)benzoate.
| Compound Name | methyl 4-chloro-2-methyl-3-(pyridin-3-ylmethylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 154752929 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | methyl 4-chloro-2-methyl-3-(pyridin-3-ylmethylcarbamoylamino)benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)NCc2cccnc2)c1C |
| InChI | InChI=1S/C16H16ClN3O3/c1-10-12(15(21)23-2)5-6-13(17)14(10)20-16(22)19-9-11-4-3-7-18-8-11/h3-8H,9H2,1-2H3,(H2,19,20,22) |
| InChIKey | XCQFRBJJSAQINT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |