C13H13N3O5S — CID 154755494
2-(3-methyl-4-nitrophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide (PubChem CID 154755494) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is 2-(3-methyl-4-nitrophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide.
| Compound Name | 2-(3-methyl-4-nitrophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 154755494 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-(3-methyl-4-nitrophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide |
| SMILES | Cc1cc(OCC(=O)NCc2csc(=O)[nH]2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N3O5S/c1-8-4-10(2-3-11(8)16(19)20)21-6-12(17)14-5-9-7-22-13(18)15-9/h2-4,7H,5-6H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | QRKKBIXTVPYEEA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|