C15H21N3O3S — CID 154755933
3-(2-methoxyethyl)-N-[(4-methylsulfanylphenyl)methyl]-4-oxoimidazolidine-1-carboxamide (PubChem CID 154755933) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-N-[(4-methylsulfanylphenyl)methyl]-4-oxoimidazolidine-1-carboxamide.
| Compound Name | 3-(2-methoxyethyl)-N-[(4-methylsulfanylphenyl)methyl]-4-oxoimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 154755933 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-(2-methoxyethyl)-N-[(4-methylsulfanylphenyl)methyl]-4-oxoimidazolidine-1-carboxamide |
| SMILES | COCCN1CN(C(=O)NCc2ccc(SC)cc2)CC1=O |
| InChI | InChI=1S/C15H21N3O3S/c1-21-8-7-17-11-18(10-14(17)19)15(20)16-9-12-3-5-13(22-2)6-4-12/h3-6H,7-11H2,1-2H3,(H,16,20) |
| InChIKey | XSNPYIFRQZWEJL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |