C16H23N7O2 — CID 154756604
1-(2-morpholin-4-ylpyrimidin-4-yl)-3-(triazol-1-ylmethyl)piperidin-3-ol (PubChem CID 154756604) has the molecular formula C16H23N7O2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylpyrimidin-4-yl)-3-(triazol-1-ylmethyl)piperidin-3-ol.
| Compound Name | 1-(2-morpholin-4-ylpyrimidin-4-yl)-3-(triazol-1-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 154756604 |
| Molecular Formula | C16H23N7O2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-(2-morpholin-4-ylpyrimidin-4-yl)-3-(triazol-1-ylmethyl)piperidin-3-ol |
| SMILES | OC1(Cn2ccnn2)CCCN(c2ccnc(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C16H23N7O2/c24-16(13-23-7-5-18-20-23)3-1-6-22(12-16)14-2-4-17-15(19-14)21-8-10-25-11-9-21/h2,4-5,7,24H,1,3,6,8-13H2 |
| InChIKey | VDWVTIKPHIUDGB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |