C14H19N5O2 — CID 154756855
1-[(2-methoxy-3-pyridinyl)methyl]-3-(2H-triazol-4-yl)piperidin-3-ol (PubChem CID 154756855) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[(2-methoxy-3-pyridinyl)methyl]-3-(2H-triazol-4-yl)piperidin-3-ol.
| Compound Name | 1-[(2-methoxy-3-pyridinyl)methyl]-3-(2H-triazol-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 154756855 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-[(2-methoxy-3-pyridinyl)methyl]-3-(2H-triazol-4-yl)piperidin-3-ol |
| SMILES | COc1ncccc1CN1CCCC(O)(c2cn[nH]n2)C1 |
| InChI | InChI=1S/C14H19N5O2/c1-21-13-11(4-2-6-15-13)9-19-7-3-5-14(20,10-19)12-8-16-18-17-12/h2,4,6,8,20H,3,5,7,9-10H2,1H3,(H,16,17,18) |
| InChIKey | CQXGXDWSSMFLQV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |