C15H26N4O2 — CID 167954203
1-[(1-hydroxy-4-methylcyclohexyl)methyl]-3-(2H-triazol-4-yl)piperidin-3-ol (PubChem CID 167954203) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[(1-hydroxy-4-methylcyclohexyl)methyl]-3-(2H-triazol-4-yl)piperidin-3-ol.
| Compound Name | 1-[(1-hydroxy-4-methylcyclohexyl)methyl]-3-(2H-triazol-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 167954203 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[(1-hydroxy-4-methylcyclohexyl)methyl]-3-(2H-triazol-4-yl)piperidin-3-ol |
| SMILES | CC1CCC(O)(CN2CCCC(O)(c3cn[nH]n3)C2)CC1 |
| InChI | InChI=1S/C15H26N4O2/c1-12-3-6-14(20,7-4-12)10-19-8-2-5-15(21,11-19)13-9-16-18-17-13/h9,12,20-21H,2-8,10-11H2,1H3,(H,16,17,18) |
| InChIKey | AEAFXTWYKILOTN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |