C15H20N4O3S — CID 167810469
1-(2,4-dimethylphenyl)sulfonyl-3-(2H-triazol-4-yl)piperidin-3-ol (PubChem CID 167810469) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)sulfonyl-3-(2H-triazol-4-yl)piperidin-3-ol.
| Compound Name | 1-(2,4-dimethylphenyl)sulfonyl-3-(2H-triazol-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 167810469 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)sulfonyl-3-(2H-triazol-4-yl)piperidin-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(O)(c3cn[nH]n3)C2)c(C)c1 |
| InChI | InChI=1S/C15H20N4O3S/c1-11-4-5-13(12(2)8-11)23(21,22)19-7-3-6-15(20,10-19)14-9-16-18-17-14/h4-5,8-9,20H,3,6-7,10H2,1-2H3,(H,16,17,18) |
| InChIKey | PQTBTWKCLBDPOW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |