About (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone
(3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone (PubChem CID 154758654) has the molecular formula C18H20FN3O2
and a molecular weight of 329.38 g/mol. Its IUPAC name is (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone |
| PubChem CID | 154758654 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone |
| SMILES | O=C(c1conc1C1CC1)N1CCC(Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C18H20FN3O2/c19-15-3-1-2-4-16(15)20-13-7-9-22(10-8-13)18(23)14-11-24-21-17(14)12-5-6-12/h1-4,11-13,20H,5-10H2 |
| InChIKey | NWVAIWJQVAKYTD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone?
The IUPAC name of (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone (CID 154758654) is (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone.
What is the SMILES notation for (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone?
The canonical SMILES for (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone is O=C(c1conc1C1CC1)N1CCC(Nc2ccccc2F)CC1.
What is the InChIKey of (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone?
The InChIKey is NWVAIWJQVAKYTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN3O2/c19-15-3-1-2-4-16(15)20-13-7-9-22(10-8-13)18(23)14-11-24-21-17(14)12-5-6-12/h1-4,11-13,20H,5-10H2.
What are the key properties of (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone?
(3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone has a molecular weight of 329.38 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(2-fluoroanilino)piperidin-1-yl]methanone is sourced from PubChem (CID 154758654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).