C16H17ClFN5O — CID 133340969
6-chloro-3-[4-(2-fluoroanilino)piperidin-1-yl]pyridazine-4-carboxamide (PubChem CID 133340969) has the molecular formula C16H17ClFN5O and a molecular weight of 349.80 g/mol. Its IUPAC name is 6-chloro-3-[4-(2-fluoroanilino)piperidin-1-yl]pyridazine-4-carboxamide.
| Compound Name | 6-chloro-3-[4-(2-fluoroanilino)piperidin-1-yl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 133340969 |
| Molecular Formula | C16H17ClFN5O |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 6-chloro-3-[4-(2-fluoroanilino)piperidin-1-yl]pyridazine-4-carboxamide |
| SMILES | NC(=O)c1cc(Cl)nnc1N1CCC(Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C16H17ClFN5O/c17-14-9-11(15(19)24)16(22-21-14)23-7-5-10(6-8-23)20-13-4-2-1-3-12(13)18/h1-4,9-10,20H,5-8H2,(H2,19,24) |
| InChIKey | SZWLUPLDBAORDJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |