C18H16F3N3 — CID 133330748
3,5-difluoro-4-[4-(2-fluoroanilino)piperidin-1-yl]benzonitrile (PubChem CID 133330748) has the molecular formula C18H16F3N3 and a molecular weight of 331.34 g/mol. Its IUPAC name is 3,5-difluoro-4-[4-(2-fluoroanilino)piperidin-1-yl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[4-(2-fluoroanilino)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133330748 |
| Molecular Formula | C18H16F3N3 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3,5-difluoro-4-[4-(2-fluoroanilino)piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1cc(F)c(N2CCC(Nc3ccccc3F)CC2)c(F)c1 |
| InChI | InChI=1S/C18H16F3N3/c19-14-3-1-2-4-17(14)23-13-5-7-24(8-6-13)18-15(20)9-12(11-22)10-16(18)21/h1-4,9-10,13,23H,5-8H2 |
| InChIKey | VYDQRHRMRFAQHG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |