C22H24N4O2S — CID 154760707
2-[[5-[2-(furan-2-yl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide (PubChem CID 154760707) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-[[5-[2-(furan-2-yl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide.
| Compound Name | 2-[[5-[2-(furan-2-yl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 154760707 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[[5-[2-(furan-2-yl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CSc1n[nH]c(C=Cc2ccco2)n1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H24N4O2S/c1-15(17-9-8-16-5-2-3-6-18(16)13-17)23-21(27)14-29-22-24-20(25-26-22)11-10-19-7-4-12-28-19/h4,7-13,15H,2-3,5-6,14H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | PGDOBEPKERVHLM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |