C24H29N5O3S — CID 55517265
3-[4-(furan-2-ylmethyl)-5-[2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl]sulfanyl-1,2,4-triazol-3-yl]propanamide (PubChem CID 55517265) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is 3-[4-(furan-2-ylmethyl)-5-[2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl]sulfanyl-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-[4-(furan-2-ylmethyl)-5-[2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl]sulfanyl-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 55517265 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 3-[4-(furan-2-ylmethyl)-5-[2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl]sulfanyl-1,2,4-triazol-3-yl]propanamide |
| SMILES | CC(NC(=O)CSc1nnc(CCC(N)=O)n1Cc1ccco1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H29N5O3S/c1-16(18-9-8-17-5-2-3-6-19(17)13-18)26-23(31)15-33-24-28-27-22(11-10-21(25)30)29(24)14-20-7-4-12-32-20/h4,7-9,12-13,16H,2-3,5-6,10-11,14-15H2,1H3,(H2,25,30)(H,26,31) |
| InChIKey | YJDOMNIUEHJQNL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |