C14H17Cl2NO2 — CID 154763093
2-(3,5-dichlorophenyl)-2-(3,3-dimethylpyrrolidin-1-yl)acetic acid (PubChem CID 154763093) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-2-(3,3-dimethylpyrrolidin-1-yl)acetic acid.
| Compound Name | 2-(3,5-dichlorophenyl)-2-(3,3-dimethylpyrrolidin-1-yl)acetic acid |
|---|---|
| PubChem CID | 154763093 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-2-(3,3-dimethylpyrrolidin-1-yl)acetic acid |
| SMILES | CC1(C)CCN(C(C(=O)O)c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2NO2/c1-14(2)3-4-17(8-14)12(13(18)19)9-5-10(15)7-11(16)6-9/h5-7,12H,3-4,8H2,1-2H3,(H,18,19) |
| InChIKey | ZKLNSDIPNONAKP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |