C15H19N5O3 — CID 154763477
4-methyl-N-[2-(1-methylpyrazol-4-yl)oxan-4-yl]-3-nitropyridin-2-amine (PubChem CID 154763477) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-methyl-N-[2-(1-methylpyrazol-4-yl)oxan-4-yl]-3-nitropyridin-2-amine.
| Compound Name | 4-methyl-N-[2-(1-methylpyrazol-4-yl)oxan-4-yl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 154763477 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-methyl-N-[2-(1-methylpyrazol-4-yl)oxan-4-yl]-3-nitropyridin-2-amine |
| SMILES | Cc1ccnc(NC2CCOC(c3cnn(C)c3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N5O3/c1-10-3-5-16-15(14(10)20(21)22)18-12-4-6-23-13(7-12)11-8-17-19(2)9-11/h3,5,8-9,12-13H,4,6-7H2,1-2H3,(H,16,18) |
| InChIKey | CYJUBCNDASDBNS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|