C17H18BrN5O — CID 167967292
6-bromo-N-[2-(1-methylpyrazol-4-yl)oxan-4-yl]quinazolin-4-amine (PubChem CID 167967292) has the molecular formula C17H18BrN5O and a molecular weight of 388.27 g/mol. Its IUPAC name is 6-bromo-N-[2-(1-methylpyrazol-4-yl)oxan-4-yl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[2-(1-methylpyrazol-4-yl)oxan-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 167967292 |
| Molecular Formula | C17H18BrN5O |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 6-bromo-N-[2-(1-methylpyrazol-4-yl)oxan-4-yl]quinazolin-4-amine |
| SMILES | Cn1cc(C2CC(Nc3ncnc4ccc(Br)cc34)CCO2)cn1 |
| InChI | InChI=1S/C17H18BrN5O/c1-23-9-11(8-21-23)16-7-13(4-5-24-16)22-17-14-6-12(18)2-3-15(14)19-10-20-17/h2-3,6,8-10,13,16H,4-5,7H2,1H3,(H,19,20,22) |
| InChIKey | NKCVDVHGPZWHGH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |