About 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine
7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine (PubChem CID 97253924) has the molecular formula C14H16ClN3O
and a molecular weight of 277.75 g/mol. Its IUPAC name is 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine.
Molecular Properties
| Compound Name | 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine |
| PubChem CID | 97253924 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine |
| SMILES | C[C@@H]1C[C@@H](Nc2ncnc3cc(Cl)ccc23)CCO1 |
| InChI | InChI=1S/C14H16ClN3O/c1-9-6-11(4-5-19-9)18-14-12-3-2-10(15)7-13(12)16-8-17-14/h2-3,7-9,11H,4-6H2,1H3,(H,16,17,18)/t9-,11+/m1/s1 |
| InChIKey | UVPZZAOCQASOBQ-KOLCDFICSA-N |
| XLogP | 3.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine?
The IUPAC name of 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine (CID 97253924) is 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine.
What is the SMILES notation for 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine?
The canonical SMILES for 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine is C[C@@H]1C[C@@H](Nc2ncnc3cc(Cl)ccc23)CCO1.
What is the InChIKey of 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine?
The InChIKey is UVPZZAOCQASOBQ-KOLCDFICSA-N. The full InChI is InChI=1S/C14H16ClN3O/c1-9-6-11(4-5-19-9)18-14-12-3-2-10(15)7-13(12)16-8-17-14/h2-3,7-9,11H,4-6H2,1H3,(H,16,17,18)/t9-,11+/m1/s1.
What are the key properties of 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine?
7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine has a molecular weight of 277.75 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-[(2R,4S)-2-methyloxan-4-yl]quinazolin-4-amine is sourced from PubChem (CID 97253924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).