C11H14IN3O2 — CID 154763502
1-(3-iodo-5-methoxy-2-pyridinyl)pyrrolidine-3-carboxamide (PubChem CID 154763502) has the molecular formula C11H14IN3O2 and a molecular weight of 347.16 g/mol. Its IUPAC name is 1-(3-iodo-5-methoxy-2-pyridinyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-iodo-5-methoxy-2-pyridinyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154763502 |
| Molecular Formula | C11H14IN3O2 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 1-(3-iodo-5-methoxy-2-pyridinyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cnc(N2CCC(C(N)=O)C2)c(I)c1 |
| InChI | InChI=1S/C11H14IN3O2/c1-17-8-4-9(12)11(14-5-8)15-3-2-7(6-15)10(13)16/h4-5,7H,2-3,6H2,1H3,(H2,13,16) |
| InChIKey | WHXXHLDPDUWNPI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|