C17H22N8O — CID 154765240
4-(1H-indol-4-yl)-N-[2-(1-methyltetrazol-5-yl)ethyl]piperazine-1-carboxamide (PubChem CID 154765240) has the molecular formula C17H22N8O and a molecular weight of 354.42 g/mol. Its IUPAC name is 4-(1H-indol-4-yl)-N-[2-(1-methyltetrazol-5-yl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(1H-indol-4-yl)-N-[2-(1-methyltetrazol-5-yl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 154765240 |
| Molecular Formula | C17H22N8O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 4-(1H-indol-4-yl)-N-[2-(1-methyltetrazol-5-yl)ethyl]piperazine-1-carboxamide |
| SMILES | Cn1nnnc1CCNC(=O)N1CCN(c2cccc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C17H22N8O/c1-23-16(20-21-22-23)6-8-19-17(26)25-11-9-24(10-12-25)15-4-2-3-14-13(15)5-7-18-14/h2-5,7,18H,6,8-12H2,1H3,(H,19,26) |
| InChIKey | USNKEXABKFVQQJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |