C14H14Cl3N3O — CID 126740582
2,2,2-trichloro-1-[4-(1H-indol-4-yl)piperazin-1-yl]ethanone (PubChem CID 126740582) has the molecular formula C14H14Cl3N3O and a molecular weight of 346.65 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-(1H-indol-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-(1H-indol-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 126740582 |
| Molecular Formula | C14H14Cl3N3O |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 2,2,2-trichloro-1-[4-(1H-indol-4-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(N1CCN(c2cccc3[nH]ccc23)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H14Cl3N3O/c15-14(16,17)13(21)20-8-6-19(7-9-20)12-3-1-2-11-10(12)4-5-18-11/h1-5,18H,6-9H2 |
| InChIKey | XAEMOUGCYFCLNH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|