C28H42Cl2N4O2 — CID 70123294
N-(cyclohexanecarbonyl)-N-[2-[4-(1H-indol-4-yl)piperazin-1-yl]ethyl]cyclohexanecarboxamide;dihydrochloride (PubChem CID 70123294) has the molecular formula C28H42Cl2N4O2 and a molecular weight of 537.58 g/mol. Its IUPAC name is N-(cyclohexanecarbonyl)-N-[2-[4-(1H-indol-4-yl)piperazin-1-yl]ethyl]cyclohexanecarboxamide;dihydrochloride.
| Compound Name | N-(cyclohexanecarbonyl)-N-[2-[4-(1H-indol-4-yl)piperazin-1-yl]ethyl]cyclohexanecarboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70123294 |
| Molecular Formula | C28H42Cl2N4O2 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | N-(cyclohexanecarbonyl)-N-[2-[4-(1H-indol-4-yl)piperazin-1-yl]ethyl]cyclohexanecarboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CCCCC1)N(CCN1CCN(c2cccc3[nH]ccc23)CC1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C28H40N4O2.2ClH/c33-27(22-8-3-1-4-9-22)32(28(34)23-10-5-2-6-11-23)21-18-30-16-19-31(20-17-30)26-13-7-12-25-24(26)14-15-29-25;;/h7,12-15,22-23,29H,1-6,8-11,16-21H2;2*1H |
| InChIKey | PRYAGLSIZVVMBT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|