C19H23N4O+ — CID 143933193
hydroxy-[3-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]phenyl]azanium (PubChem CID 143933193) has the molecular formula C19H23N4O+ and a molecular weight of 323.42 g/mol. Its IUPAC name is hydroxy-[3-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]phenyl]azanium.
| Compound Name | hydroxy-[3-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]phenyl]azanium |
|---|---|
| PubChem CID | 143933193 |
| Molecular Formula | C19H23N4O+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | hydroxy-[3-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]phenyl]azanium |
| SMILES | O[NH2+]c1cccc(CN2CCN(c3cccc4[nH]ccc34)CC2)c1 |
| InChI | InChI=1S/C19H22N4O/c24-21-16-4-1-3-15(13-16)14-22-9-11-23(12-10-22)19-6-2-5-18-17(19)7-8-20-18/h1-8,13,20-21,24H,9-12,14H2/p+1 |
| InChIKey | ZKZSIVIOESQTEB-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|