C22H23IN4O — CID 139991044
2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-3-iodo-6-methoxy-1H-indole (PubChem CID 139991044) has the molecular formula C22H23IN4O and a molecular weight of 486.36 g/mol. Its IUPAC name is 2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-3-iodo-6-methoxy-1H-indole.
| Compound Name | 2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-3-iodo-6-methoxy-1H-indole |
|---|---|
| PubChem CID | 139991044 |
| Molecular Formula | C22H23IN4O |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-3-iodo-6-methoxy-1H-indole |
| SMILES | COc1ccc2c(I)c(CN3CCN(c4cccc5[nH]ccc45)CC3)[nH]c2c1 |
| InChI | InChI=1S/C22H23IN4O/c1-28-15-5-6-17-19(13-15)25-20(22(17)23)14-26-9-11-27(12-10-26)21-4-2-3-18-16(21)7-8-24-18/h2-8,13,24-25H,9-12,14H2,1H3 |
| InChIKey | RJQKAVKGJHGLDX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|