C34H32N4O — CID 139991053
[2-[4-[2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-1H-indol-3-yl]phenyl]phenyl]methanol (PubChem CID 139991053) has the molecular formula C34H32N4O and a molecular weight of 512.66 g/mol. Its IUPAC name is [2-[4-[2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-1H-indol-3-yl]phenyl]phenyl]methanol.
| Compound Name | [2-[4-[2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-1H-indol-3-yl]phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 139991053 |
| Molecular Formula | C34H32N4O |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | [2-[4-[2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-1H-indol-3-yl]phenyl]phenyl]methanol |
| SMILES | OCc1ccccc1-c1ccc(-c2c(CN3CCN(c4cccc5[nH]ccc45)CC3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C34H32N4O/c39-23-26-6-1-2-7-27(26)24-12-14-25(15-13-24)34-29-8-3-4-9-31(29)36-32(34)22-37-18-20-38(21-19-37)33-11-5-10-30-28(33)16-17-35-30/h1-17,35-36,39H,18-23H2 |
| InChIKey | NVTGDCDQKVUKBQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |