C27H29N3O2 — CID 132543340
6-methoxy-3-(4-methoxyphenyl)-2-[(4-phenylpiperazin-1-yl)methyl]-1H-indole (PubChem CID 132543340) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 6-methoxy-3-(4-methoxyphenyl)-2-[(4-phenylpiperazin-1-yl)methyl]-1H-indole.
| Compound Name | 6-methoxy-3-(4-methoxyphenyl)-2-[(4-phenylpiperazin-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 132543340 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 6-methoxy-3-(4-methoxyphenyl)-2-[(4-phenylpiperazin-1-yl)methyl]-1H-indole |
| SMILES | COc1ccc(-c2c(CN3CCN(c4ccccc4)CC3)[nH]c3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C27H29N3O2/c1-31-22-10-8-20(9-11-22)27-24-13-12-23(32-2)18-25(24)28-26(27)19-29-14-16-30(17-15-29)21-6-4-3-5-7-21/h3-13,18,28H,14-17,19H2,1-2H3 |
| InChIKey | XVMYQDFXEXWTRZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |