C22H26ClN3S — CID 10111569
4-[4-[4-(3-chlorophenyl)sulfanylbutyl]piperazin-1-yl]-1H-indole (PubChem CID 10111569) has the molecular formula C22H26ClN3S and a molecular weight of 399.99 g/mol. Its IUPAC name is 4-[4-[4-(3-chlorophenyl)sulfanylbutyl]piperazin-1-yl]-1H-indole.
| Compound Name | 4-[4-[4-(3-chlorophenyl)sulfanylbutyl]piperazin-1-yl]-1H-indole |
|---|---|
| PubChem CID | 10111569 |
| Molecular Formula | C22H26ClN3S |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-[4-[4-(3-chlorophenyl)sulfanylbutyl]piperazin-1-yl]-1H-indole |
| SMILES | Clc1cccc(SCCCCN2CCN(c3cccc4[nH]ccc34)CC2)c1 |
| InChI | InChI=1S/C22H26ClN3S/c23-18-5-3-6-19(17-18)27-16-2-1-11-25-12-14-26(15-13-25)22-8-4-7-21-20(22)9-10-24-21/h3-10,17,24H,1-2,11-16H2 |
| InChIKey | IYUIXPNEWYBZFH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|