C15H18ClN3O — CID 158915053
1-[4-(6-chloro-1H-indol-4-yl)-1,4-diazepan-1-yl]ethanone (PubChem CID 158915053) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-[4-(6-chloro-1H-indol-4-yl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(6-chloro-1H-indol-4-yl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 158915053 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-[4-(6-chloro-1H-indol-4-yl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2cc(Cl)cc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C15H18ClN3O/c1-11(20)18-5-2-6-19(8-7-18)15-10-12(16)9-14-13(15)3-4-17-14/h3-4,9-10,17H,2,5-8H2,1H3 |
| InChIKey | HWOMOVCWLZHFED-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |