C18H34N2O3 — CID 154766337
tert-butyl 3-[3-(1-hydroxycyclobutyl)propylamino]-2-methylpiperidine-1-carboxylate (PubChem CID 154766337) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is tert-butyl 3-[3-(1-hydroxycyclobutyl)propylamino]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(1-hydroxycyclobutyl)propylamino]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 154766337 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | tert-butyl 3-[3-(1-hydroxycyclobutyl)propylamino]-2-methylpiperidine-1-carboxylate |
| SMILES | CC1C(NCCCC2(O)CCC2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34N2O3/c1-14-15(19-12-7-11-18(22)9-6-10-18)8-5-13-20(14)16(21)23-17(2,3)4/h14-15,19,22H,5-13H2,1-4H3 |
| InChIKey | GOZVVRSJRNMKPT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|