C15H27NO2S — CID 154766369
5-[(2-hydroxy-2-thiophen-3-ylpropyl)amino]-3-methylheptan-3-ol (PubChem CID 154766369) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is 5-[(2-hydroxy-2-thiophen-3-ylpropyl)amino]-3-methylheptan-3-ol.
| Compound Name | 5-[(2-hydroxy-2-thiophen-3-ylpropyl)amino]-3-methylheptan-3-ol |
|---|---|
| PubChem CID | 154766369 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 5-[(2-hydroxy-2-thiophen-3-ylpropyl)amino]-3-methylheptan-3-ol |
| SMILES | CCC(CC(C)(O)CC)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C15H27NO2S/c1-5-13(9-14(3,17)6-2)16-11-15(4,18)12-7-8-19-10-12/h7-8,10,13,16-18H,5-6,9,11H2,1-4H3 |
| InChIKey | LRSNGVDWDPOXIQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |