C19H21N5O2 — CID 154767252
N-[[3-[(3S)-1-(cyanomethyl)pyrrolidin-3-yl]oxy-4-pyridinyl]methyl]-3-methylpyridine-4-carboxamide (PubChem CID 154767252) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[[3-[(3S)-1-(cyanomethyl)pyrrolidin-3-yl]oxy-4-pyridinyl]methyl]-3-methylpyridine-4-carboxamide.
| Compound Name | N-[[3-[(3S)-1-(cyanomethyl)pyrrolidin-3-yl]oxy-4-pyridinyl]methyl]-3-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 154767252 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[[3-[(3S)-1-(cyanomethyl)pyrrolidin-3-yl]oxy-4-pyridinyl]methyl]-3-methylpyridine-4-carboxamide |
| SMILES | Cc1cnccc1C(=O)NCc1ccncc1O[C@H]1CCN(CC#N)C1 |
| InChI | InChI=1S/C19H21N5O2/c1-14-10-21-7-3-17(14)19(25)23-11-15-2-6-22-12-18(15)26-16-4-8-24(13-16)9-5-20/h2-3,6-7,10,12,16H,4,8-9,11,13H2,1H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | YEFKROYOMNVZNA-INIZCTEOSA-N |
| XLogP | 1.69 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|