C20H24N4O4 — CID 154769440
5-methyl-1-[4-(4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine-6-carbonyl)phenyl]pyrazole-4-carboxylic acid (PubChem CID 154769440) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-methyl-1-[4-(4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine-6-carbonyl)phenyl]pyrazole-4-carboxylic acid.
| Compound Name | 5-methyl-1-[4-(4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine-6-carbonyl)phenyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 154769440 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 5-methyl-1-[4-(4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine-6-carbonyl)phenyl]pyrazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cnn1-c1ccc(C(=O)N2CCC3OCCN(C)C3C2)cc1 |
| InChI | InChI=1S/C20H24N4O4/c1-13-16(20(26)27)11-21-24(13)15-5-3-14(4-6-15)19(25)23-8-7-18-17(12-23)22(2)9-10-28-18/h3-6,11,17-18H,7-10,12H2,1-2H3,(H,26,27) |
| InChIKey | MSWBYMGTCFNZNE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |