C22H21N3O3 — CID 75383497
5-methyl-1-[4-(3-phenylpyrrolidine-1-carbonyl)phenyl]pyrazole-4-carboxylic acid (PubChem CID 75383497) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 5-methyl-1-[4-(3-phenylpyrrolidine-1-carbonyl)phenyl]pyrazole-4-carboxylic acid.
| Compound Name | 5-methyl-1-[4-(3-phenylpyrrolidine-1-carbonyl)phenyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 75383497 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 5-methyl-1-[4-(3-phenylpyrrolidine-1-carbonyl)phenyl]pyrazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cnn1-c1ccc(C(=O)N2CCC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-15-20(22(27)28)13-23-25(15)19-9-7-17(8-10-19)21(26)24-12-11-18(14-24)16-5-3-2-4-6-16/h2-10,13,18H,11-12,14H2,1H3,(H,27,28) |
| InChIKey | QOUMHRMXVDBLSX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |