C13H16ClN3O4 — CID 154769677
2-[4-(4-chloro-1-ethylpyrrole-2-carbonyl)piperazin-1-yl]-2-oxoacetic acid (PubChem CID 154769677) has the molecular formula C13H16ClN3O4 and a molecular weight of 313.74 g/mol. Its IUPAC name is 2-[4-(4-chloro-1-ethylpyrrole-2-carbonyl)piperazin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[4-(4-chloro-1-ethylpyrrole-2-carbonyl)piperazin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 154769677 |
| Molecular Formula | C13H16ClN3O4 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[4-(4-chloro-1-ethylpyrrole-2-carbonyl)piperazin-1-yl]-2-oxoacetic acid |
| SMILES | CCn1cc(Cl)cc1C(=O)N1CCN(C(=O)C(=O)O)CC1 |
| InChI | InChI=1S/C13H16ClN3O4/c1-2-15-8-9(14)7-10(15)11(18)16-3-5-17(6-4-16)12(19)13(20)21/h7-8H,2-6H2,1H3,(H,20,21) |
| InChIKey | JYAVVISNSCFHLU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|